C2H6N4O4 — CID 10130041
2,2-dinitroethane-1,1-diamine (PubChem CID 10130041) has the molecular formula C2H6N4O4 and a molecular weight of 150.09 g/mol. Its IUPAC name is 2,2-dinitroethane-1,1-diamine.
| Compound Name | 2,2-dinitroethane-1,1-diamine |
|---|---|
| PubChem CID | 10130041 |
| Molecular Formula | C2H6N4O4 |
| Molecular Weight | 150.09 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 2,2-dinitroethane-1,1-diamine |
| SMILES | NC(N)C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2H6N4O4/c3-1(4)2(5(7)8)6(9)10/h1-2H,3-4H2 |
| InChIKey | CQUGMNZDMWRAAN-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.09 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|