C10H10Cl3NO2S — CID 101314973
2-(2,2,2-trichloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 101314973) has the molecular formula C10H10Cl3NO2S and a molecular weight of 314.62 g/mol. Its IUPAC name is 2-(2,2,2-trichloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(2,2,2-trichloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 101314973 |
| Molecular Formula | C10H10Cl3NO2S |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 2-(2,2,2-trichloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1SCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3NO2S/c11-10(12,13)5-17-14-8(15)6-3-1-2-4-7(6)9(14)16/h1-2,6-7H,3-5H2 |
| InChIKey | YTUKLZSOURQPGR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|