C12H13N2O9- — CID 10131549
(2R)-2-amino-3-[carboxy-[2-[hydroxy(oxido)amino]phenyl]methoxy]carbonyloxypropanoic acid (PubChem CID 10131549) has the molecular formula C12H13N2O9- and a molecular weight of 329.24 g/mol. Its IUPAC name is (2R)-2-amino-3-[carboxy-[2-[hydroxy(oxido)amino]phenyl]methoxy]carbonyloxypropanoic acid.
| Compound Name | (2R)-2-amino-3-[carboxy-[2-[hydroxy(oxido)amino]phenyl]methoxy]carbonyloxypropanoic acid |
|---|---|
| PubChem CID | 10131549 |
| Molecular Formula | C12H13N2O9- |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (2R)-2-amino-3-[carboxy-[2-[hydroxy(oxido)amino]phenyl]methoxy]carbonyloxypropanoic acid |
| SMILES | N[C@H](COC(=O)OC(C(=O)O)c1ccccc1N([O-])O)C(=O)O |
| InChI | InChI=1S/C12H13N2O9/c13-7(10(15)16)5-22-12(19)23-9(11(17)18)6-3-1-2-4-8(6)14(20)21/h1-4,7,9,20H,5,13H2,(H,15,16)(H,17,18)/q-1/t7-,9?/m1/s1 |
| InChIKey | DIXXKNWVMDHIFG-YOXFSPIKSA-N |
| XLogP | 0.07 |
| TPSA | 182.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|