C18H17N2O8- — CID 10178454
(2R)-2-[[carboxy-[2-[hydroxy(oxido)amino]phenyl]methoxy]carbonylamino]-3-phenylpropanoic acid (PubChem CID 10178454) has the molecular formula C18H17N2O8- and a molecular weight of 389.34 g/mol. Its IUPAC name is (2R)-2-[[carboxy-[2-[hydroxy(oxido)amino]phenyl]methoxy]carbonylamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[carboxy-[2-[hydroxy(oxido)amino]phenyl]methoxy]carbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10178454 |
| Molecular Formula | C18H17N2O8- |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (2R)-2-[[carboxy-[2-[hydroxy(oxido)amino]phenyl]methoxy]carbonylamino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)OC(C(=O)O)c1ccccc1N([O-])O |
| InChI | InChI=1S/C18H17N2O8/c21-16(22)13(10-11-6-2-1-3-7-11)19-18(25)28-15(17(23)24)12-8-4-5-9-14(12)20(26)27/h1-9,13,15,26H,10H2,(H,19,25)(H,21,22)(H,23,24)/q-1/t13-,15?/m1/s1 |
| InChIKey | SVKSVQYBBGNRBV-AFYYWNPRSA-N |
| XLogP | 1.93 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|