C17H17N2O6- — CID 163160704
(2S)-2-[[2-[hydroxy(oxido)amino]phenyl]methoxycarbonylamino]-3-phenylpropanoic acid (PubChem CID 163160704) has the molecular formula C17H17N2O6- and a molecular weight of 345.33 g/mol. Its IUPAC name is (2S)-2-[[2-[hydroxy(oxido)amino]phenyl]methoxycarbonylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-[hydroxy(oxido)amino]phenyl]methoxycarbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 163160704 |
| Molecular Formula | C17H17N2O6- |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2S)-2-[[2-[hydroxy(oxido)amino]phenyl]methoxycarbonylamino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)O)OCc1ccccc1N([O-])O |
| InChI | InChI=1S/C17H17N2O6/c20-16(21)14(10-12-6-2-1-3-7-12)18-17(22)25-11-13-8-4-5-9-15(13)19(23)24/h1-9,14,23H,10-11H2,(H,18,22)(H,20,21)/q-1/t14-/m0/s1 |
| InChIKey | NUMGVAIULLGLLF-AWEZNQCLSA-N |
| XLogP | 2.30 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|