C14H16N2O7S2 — CID 174884413
2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;2-benzofuran-1,3-dione (PubChem CID 174884413) has the molecular formula C14H16N2O7S2 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;2-benzofuran-1,3-dione.
| Compound Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 174884413 |
| Molecular Formula | C14H16N2O7S2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;2-benzofuran-1,3-dione |
| SMILES | NC(CSSCC(N)C(=O)O)C(=O)O.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.C6H12N2O4S2/c9-7-5-3-1-2-4-6(5)8(10)11-7;7-3(5(9)10)1-13-14-2-4(8)6(11)12/h1-4H;3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| InChIKey | OFQJLBVCISRVQR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|