C12H16O4 — CID 101326376
[3,4-bis(hydroxymethyl)-5-prop-2-enoxyphenyl]methanol (PubChem CID 101326376) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is [3,4-bis(hydroxymethyl)-5-prop-2-enoxyphenyl]methanol.
| Compound Name | [3,4-bis(hydroxymethyl)-5-prop-2-enoxyphenyl]methanol |
|---|---|
| PubChem CID | 101326376 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [3,4-bis(hydroxymethyl)-5-prop-2-enoxyphenyl]methanol |
| SMILES | C=CCOc1cc(CO)cc(CO)c1CO |
| InChI | InChI=1S/C12H16O4/c1-2-3-16-12-5-9(6-13)4-10(7-14)11(12)8-15/h2,4-5,13-15H,1,3,6-8H2 |
| InChIKey | KWZWFOUSTDVEBI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|