C14H26N2O — CID 101327908
1-(2-non-8-enyl-1,2-dihydroimidazol-3-yl)ethanol (PubChem CID 101327908) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-(2-non-8-enyl-1,2-dihydroimidazol-3-yl)ethanol.
| Compound Name | 1-(2-non-8-enyl-1,2-dihydroimidazol-3-yl)ethanol |
|---|---|
| PubChem CID | 101327908 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-(2-non-8-enyl-1,2-dihydroimidazol-3-yl)ethanol |
| SMILES | C=CCCCCCCCC1NC=CN1C(C)O |
| InChI | InChI=1S/C14H26N2O/c1-3-4-5-6-7-8-9-10-14-15-11-12-16(14)13(2)17/h3,11-15,17H,1,4-10H2,2H3 |
| InChIKey | SDKXUPVIWHCIBV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|