C19H36N2O — CID 101328071
1-[2-[(E)-tetradec-12-enyl]-1,2-dihydroimidazol-3-yl]ethanol (PubChem CID 101328071) has the molecular formula C19H36N2O and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-[2-[(E)-tetradec-12-enyl]-1,2-dihydroimidazol-3-yl]ethanol.
| Compound Name | 1-[2-[(E)-tetradec-12-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
|---|---|
| PubChem CID | 101328071 |
| Molecular Formula | C19H36N2O |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.28 |
| IUPAC Name | 1-[2-[(E)-tetradec-12-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
| SMILES | C/C=C/CCCCCCCCCCCC1NC=CN1C(C)O |
| InChI | InChI=1S/C19H36N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-20-16-17-21(19)18(2)22/h3-4,16-20,22H,5-15H2,1-2H3/b4-3+ |
| InChIKey | MVWRQDTXBHQJJR-ONEGZZNKSA-N |
| XLogP | 4.89 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|