C21H41N3 — CID 101323422
1-[2-[(E)-hexadec-12-enyl]-1,2-dihydroimidazol-3-yl]ethanamine (PubChem CID 101323422) has the molecular formula C21H41N3 and a molecular weight of 335.58 g/mol. Its IUPAC name is 1-[2-[(E)-hexadec-12-enyl]-1,2-dihydroimidazol-3-yl]ethanamine.
| Compound Name | 1-[2-[(E)-hexadec-12-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 101323422 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 1-[2-[(E)-hexadec-12-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCC/C=C/CCCCCCCCCCCC1NC=CN1C(C)N |
| InChI | InChI=1S/C21H41N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-23-18-19-24(21)20(2)22/h5-6,18-21,23H,3-4,7-17,22H2,1-2H3/b6-5+ |
| InChIKey | CLLLFJRDIIRWRK-AATRIKPKSA-N |
| XLogP | 5.64 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|