C18H35N3 — CID 101323172
1-[2-[(E)-tridec-2-enyl]-1,2-dihydroimidazol-3-yl]ethanamine (PubChem CID 101323172) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is 1-[2-[(E)-tridec-2-enyl]-1,2-dihydroimidazol-3-yl]ethanamine.
| Compound Name | 1-[2-[(E)-tridec-2-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 101323172 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 1-[2-[(E)-tridec-2-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCCCCCCCCC/C=C/CC1NC=CN1C(C)N |
| InChI | InChI=1S/C18H35N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-20-15-16-21(18)17(2)19/h12-13,15-18,20H,3-11,14,19H2,1-2H3/b13-12+ |
| InChIKey | LODVQRDPGNFVDR-OUKQBFOZSA-N |
| XLogP | 4.47 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|