C18H34N2O — CID 101328030
1-[2-[(E)-tridec-9-enyl]-1,2-dihydroimidazol-3-yl]ethanol (PubChem CID 101328030) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 1-[2-[(E)-tridec-9-enyl]-1,2-dihydroimidazol-3-yl]ethanol.
| Compound Name | 1-[2-[(E)-tridec-9-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
|---|---|
| PubChem CID | 101328030 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 1-[2-[(E)-tridec-9-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
| SMILES | CCC/C=C/CCCCCCCCC1NC=CN1C(C)O |
| InChI | InChI=1S/C18H34N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-19-15-16-20(18)17(2)21/h5-6,15-19,21H,3-4,7-14H2,1-2H3/b6-5+ |
| InChIKey | CHJDITGSVJQDNK-AATRIKPKSA-N |
| XLogP | 4.50 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|