C22H43N3 — CID 101323508
1-[2-[(E)-heptadec-7-enyl]-1,2-dihydroimidazol-3-yl]ethanamine (PubChem CID 101323508) has the molecular formula C22H43N3 and a molecular weight of 349.61 g/mol. Its IUPAC name is 1-[2-[(E)-heptadec-7-enyl]-1,2-dihydroimidazol-3-yl]ethanamine.
| Compound Name | 1-[2-[(E)-heptadec-7-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 101323508 |
| Molecular Formula | C22H43N3 |
| Molecular Weight | 349.61 g/mol |
| Exact Mass | 349.35 |
| IUPAC Name | 1-[2-[(E)-heptadec-7-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCCCCCCCC/C=C/CCCCCCC1NC=CN1C(C)N |
| InChI | InChI=1S/C22H43N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-24-19-20-25(22)21(2)23/h11-12,19-22,24H,3-10,13-18,23H2,1-2H3/b12-11+ |
| InChIKey | KUYJBORIVDIKLQ-VAWYXSNFSA-N |
| XLogP | 6.03 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|