C22H42N2O — CID 101328197
1-[2-[(E)-heptadec-10-enyl]-1,2-dihydroimidazol-3-yl]ethanol (PubChem CID 101328197) has the molecular formula C22H42N2O and a molecular weight of 350.59 g/mol. Its IUPAC name is 1-[2-[(E)-heptadec-10-enyl]-1,2-dihydroimidazol-3-yl]ethanol.
| Compound Name | 1-[2-[(E)-heptadec-10-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
|---|---|
| PubChem CID | 101328197 |
| Molecular Formula | C22H42N2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.33 |
| IUPAC Name | 1-[2-[(E)-heptadec-10-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
| SMILES | CCCCCC/C=C/CCCCCCCCCC1NC=CN1C(C)O |
| InChI | InChI=1S/C22H42N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-23-19-20-24(22)21(2)25/h8-9,19-23,25H,3-7,10-18H2,1-2H3/b9-8+ |
| InChIKey | ZDNAGLYAVVDFNL-CMDGGOBGSA-N |
| XLogP | 6.06 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|