C19H37N3 — CID 101323252
1-[2-[(E)-tetradec-8-enyl]-1,2-dihydroimidazol-3-yl]ethanamine (PubChem CID 101323252) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is 1-[2-[(E)-tetradec-8-enyl]-1,2-dihydroimidazol-3-yl]ethanamine.
| Compound Name | 1-[2-[(E)-tetradec-8-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 101323252 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | 1-[2-[(E)-tetradec-8-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCCCC/C=C/CCCCCCCC1NC=CN1C(C)N |
| InChI | InChI=1S/C19H37N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-21-16-17-22(19)18(2)20/h7-8,16-19,21H,3-6,9-15,20H2,1-2H3/b8-7+ |
| InChIKey | TXNGTMCMCLLVIR-BQYQJAHWSA-N |
| XLogP | 4.86 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|