C20H24N2O2S — CID 10132948
[(3S)-6-(benzenesulfonyl)-9,9-dimethyl-1,2,3,4,4a,9a-hexahydrocarbazol-9-ium-3-yl]azanide (PubChem CID 10132948) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is [(3S)-6-(benzenesulfonyl)-9,9-dimethyl-1,2,3,4,4a,9a-hexahydrocarbazol-9-ium-3-yl]azanide.
| Compound Name | [(3S)-6-(benzenesulfonyl)-9,9-dimethyl-1,2,3,4,4a,9a-hexahydrocarbazol-9-ium-3-yl]azanide |
|---|---|
| PubChem CID | 10132948 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(3S)-6-(benzenesulfonyl)-9,9-dimethyl-1,2,3,4,4a,9a-hexahydrocarbazol-9-ium-3-yl]azanide |
| SMILES | C[N+]1(C)c2ccc(S(=O)(=O)c3ccccc3)cc2C2C[C@@H]([NH-])CCC21 |
| InChI | InChI=1S/C20H24N2O2S/c1-22(2)19-10-8-14(21)12-17(19)18-13-16(9-11-20(18)22)25(23,24)15-6-4-3-5-7-15/h3-7,9,11,13-14,17,19,21H,8,10,12H2,1-2H3/t14-,17?,19?/m0/s1 |
| InChIKey | ZAINTASNIHHDPR-STJZUHDESA-N |
| XLogP | 4.16 |
| TPSA | 57.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|