C14H18O4 — CID 101333291
(4aS)-8-methyl-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione (PubChem CID 101333291) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (4aS)-8-methyl-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione.
| Compound Name | (4aS)-8-methyl-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione |
|---|---|
| PubChem CID | 101333291 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (4aS)-8-methyl-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione |
| SMILES | CC1=C2OCC(=O)O[C@@]2(CCC(C)C)C=CC1=O |
| InChI | InChI=1S/C14H18O4/c1-9(2)4-6-14-7-5-11(15)10(3)13(14)17-8-12(16)18-14/h5,7,9H,4,6,8H2,1-3H3/t14-/m0/s1 |
| InChIKey | KYZIWZMUVOQARJ-AWEZNQCLSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |