About (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione
(4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione (PubChem CID 134972252) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione.
Molecular Properties
| Compound Name | (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione |
| PubChem CID | 134972252 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione |
| SMILES | CC(C)CC[C@]12C=CC(=O)C=C1OCC(=O)O2 |
| InChI | InChI=1S/C13H16O4/c1-9(2)3-5-13-6-4-10(14)7-11(13)16-8-12(15)17-13/h4,6-7,9H,3,5,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | WUNVLKYAXXZUPW-ZDUSSCGKSA-N |
| XLogP | 1.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione?
The IUPAC name of (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione (CID 134972252) is (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione.
What is the SMILES notation for (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione?
The canonical SMILES for (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione is CC(C)CC[C@]12C=CC(=O)C=C1OCC(=O)O2.
What is the InChIKey of (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione?
The InChIKey is WUNVLKYAXXZUPW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H16O4/c1-9(2)3-5-13-6-4-10(14)7-11(13)16-8-12(15)17-13/h4,6-7,9H,3,5,8H2,1-2H3/t13-/m0/s1.
What are the key properties of (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione?
(4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione has a molecular weight of 236.27 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4aS)-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione is sourced from PubChem (CID 134972252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).