C14H16O5 — CID 101333295
3,5-dimethoxy-1,9-dimethyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-10-one (PubChem CID 101333295) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3,5-dimethoxy-1,9-dimethyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-10-one.
| Compound Name | 3,5-dimethoxy-1,9-dimethyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-10-one |
|---|---|
| PubChem CID | 101333295 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3,5-dimethoxy-1,9-dimethyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-10-one |
| SMILES | COc1cc2c(c(OC)c1)C1(C)OC(=O)C(C)(C2)O1 |
| InChI | InChI=1S/C14H16O5/c1-13-7-8-5-9(16-3)6-10(17-4)11(8)14(2,19-13)18-12(13)15/h5-6H,7H2,1-4H3 |
| InChIKey | PYIHJGWXGMCSPN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |