C16H20O5 — CID 134958496
(3R)-3-prop-2-enyl-3-(2,4,6-trimethoxyphenyl)oxolan-2-one (PubChem CID 134958496) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (3R)-3-prop-2-enyl-3-(2,4,6-trimethoxyphenyl)oxolan-2-one.
| Compound Name | (3R)-3-prop-2-enyl-3-(2,4,6-trimethoxyphenyl)oxolan-2-one |
|---|---|
| PubChem CID | 134958496 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3R)-3-prop-2-enyl-3-(2,4,6-trimethoxyphenyl)oxolan-2-one |
| SMILES | C=CC[C@]1(c2c(OC)cc(OC)cc2OC)CCOC1=O |
| InChI | InChI=1S/C16H20O5/c1-5-6-16(7-8-21-15(16)17)14-12(19-3)9-11(18-2)10-13(14)20-4/h5,9-10H,1,6-8H2,2-4H3/t16-/m1/s1 |
| InChIKey | WZOMCFDOQDKTCP-MRXNPFEDSA-N |
| XLogP | 2.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|