C21H22N2OS — CID 101334197
2-[(2S,3S)-1-[(1S)-2-methoxy-1-phenylethyl]-3-phenylaziridin-2-yl]-4-methyl-1,3-thiazole (PubChem CID 101334197) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-[(2S,3S)-1-[(1S)-2-methoxy-1-phenylethyl]-3-phenylaziridin-2-yl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[(2S,3S)-1-[(1S)-2-methoxy-1-phenylethyl]-3-phenylaziridin-2-yl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 101334197 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[(2S,3S)-1-[(1S)-2-methoxy-1-phenylethyl]-3-phenylaziridin-2-yl]-4-methyl-1,3-thiazole |
| SMILES | COC[C@H](c1ccccc1)N1[C@H](c2nc(C)cs2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22N2OS/c1-15-14-25-21(22-15)20-19(17-11-7-4-8-12-17)23(20)18(13-24-2)16-9-5-3-6-10-16/h3-12,14,18-20H,13H2,1-2H3/t18-,19+,20+,23?/m1/s1 |
| InChIKey | HMVSQYMJGCMFPM-DHDCEYHBSA-N |
| XLogP | 4.94 |
| TPSA | 25.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|