C16H14N4S — CID 101455716
4-methyl-2-[(2S,3R)-1-pyridin-2-yl-3-pyridin-4-ylaziridin-2-yl]-1,3-thiazole (PubChem CID 101455716) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-methyl-2-[(2S,3R)-1-pyridin-2-yl-3-pyridin-4-ylaziridin-2-yl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[(2S,3R)-1-pyridin-2-yl-3-pyridin-4-ylaziridin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 101455716 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-methyl-2-[(2S,3R)-1-pyridin-2-yl-3-pyridin-4-ylaziridin-2-yl]-1,3-thiazole |
| SMILES | Cc1csc([C@@H]2[C@@H](c3ccncc3)N2c2ccccn2)n1 |
| InChI | InChI=1S/C16H14N4S/c1-11-10-21-16(19-11)15-14(12-5-8-17-9-6-12)20(15)13-4-2-3-7-18-13/h2-10,14-15H,1H3/t14-,15+,20?/m1/s1 |
| InChIKey | IEXQUQNHNOZKMQ-FKTKBCEVSA-N |
| XLogP | 3.54 |
| TPSA | 41.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|