C22H26N2O2 — CID 101334198
2-[(2R,3R)-1-[(1R)-2-methoxy-1-phenylethyl]-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 101334198) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[(2R,3R)-1-[(1R)-2-methoxy-1-phenylethyl]-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2R,3R)-1-[(1R)-2-methoxy-1-phenylethyl]-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 101334198 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[(2R,3R)-1-[(1R)-2-methoxy-1-phenylethyl]-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | COC[C@@H](c1ccccc1)N1[C@H](c2ccccc2)[C@@H]1C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C22H26N2O2/c1-22(2)15-26-21(23-22)20-19(17-12-8-5-9-13-17)24(20)18(14-25-3)16-10-6-4-7-11-16/h4-13,18-20H,14-15H2,1-3H3/t18-,19+,20+,24?/m0/s1 |
| InChIKey | PNJXZQWGHRXEIK-SLLHVTCXSA-N |
| XLogP | 4.01 |
| TPSA | 33.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|