C23H23NO3 — CID 11057528
(13S,17R)-16-[(1R)-2-methoxy-1-phenylethyl]-11,15-dioxa-16-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene (PubChem CID 11057528) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (13S,17R)-16-[(1R)-2-methoxy-1-phenylethyl]-11,15-dioxa-16-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene.
| Compound Name | (13S,17R)-16-[(1R)-2-methoxy-1-phenylethyl]-11,15-dioxa-16-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 11057528 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (13S,17R)-16-[(1R)-2-methoxy-1-phenylethyl]-11,15-dioxa-16-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene |
| SMILES | COC[C@@H](c1ccccc1)N1OC[C@@H]2COc3ccc4ccccc4c3[C@@H]21 |
| InChI | InChI=1S/C23H23NO3/c1-25-15-20(17-8-3-2-4-9-17)24-23-18(14-27-24)13-26-21-12-11-16-7-5-6-10-19(16)22(21)23/h2-12,18,20,23H,13-15H2,1H3/t18-,20-,23+/m0/s1 |
| InChIKey | APTNAUBJXVLSPX-GREBRCKQSA-N |
| XLogP | 4.52 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |