C22H26N2O — CID 101334205
4,4-dimethyl-2-[(2R,3S)-2-methyl-3-phenyl-1-[(1R)-1-phenylethyl]aziridin-2-yl]-5H-1,3-oxazole (PubChem CID 101334205) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-phenyl-1-[(1R)-1-phenylethyl]aziridin-2-yl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-phenyl-1-[(1R)-1-phenylethyl]aziridin-2-yl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 101334205 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-phenyl-1-[(1R)-1-phenylethyl]aziridin-2-yl]-5H-1,3-oxazole |
| SMILES | C[C@H](c1ccccc1)N1[C@@H](c2ccccc2)[C@]1(C)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C22H26N2O/c1-16(17-11-7-5-8-12-17)24-19(18-13-9-6-10-14-18)22(24,4)20-23-21(2,3)15-25-20/h5-14,16,19H,15H2,1-4H3/t16-,19+,22-,24?/m1/s1 |
| InChIKey | MRFJDLIGLJQIMF-ZJSMKRBRSA-N |
| XLogP | 4.77 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|