C26H27N2O2P — CID 102209401
2-[(2S,3R)-3-deuterio-1-diphenylphosphoryl-2-methyl-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 102209401) has the molecular formula C26H27N2O2P and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[(2S,3R)-3-deuterio-1-diphenylphosphoryl-2-methyl-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2S,3R)-3-deuterio-1-diphenylphosphoryl-2-methyl-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 102209401 |
| Molecular Formula | C26H27N2O2P |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-[(2S,3R)-3-deuterio-1-diphenylphosphoryl-2-methyl-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | [2H][C@]1(c2ccccc2)N(P(=O)(c2ccccc2)c2ccccc2)[C@]1(C)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C26H27N2O2P/c1-25(2)19-30-24(27-25)26(3)23(20-13-7-4-8-14-20)28(26)31(29,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23H,19H2,1-3H3/t23-,26+,28?/m1/s1/i23D |
| InChIKey | BOBHFSRZCOAEHY-JSODRSSSSA-N |
| XLogP | 4.94 |
| TPSA | 41.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|