C25H25N2O3P — CID 132536850
N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-diphenylphosphorylacetamide (PubChem CID 132536850) has the molecular formula C25H25N2O3P and a molecular weight of 432.46 g/mol. Its IUPAC name is N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-diphenylphosphorylacetamide.
| Compound Name | N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-diphenylphosphorylacetamide |
|---|---|
| PubChem CID | 132536850 |
| Molecular Formula | C25H25N2O3P |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-diphenylphosphorylacetamide |
| SMILES | CC1(C)COC(c2ccccc2NC(=O)CP(=O)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C25H25N2O3P/c1-25(2)18-30-24(27-25)21-15-9-10-16-22(21)26-23(28)17-31(29,19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16H,17-18H2,1-2H3,(H,26,28) |
| InChIKey | AYVRVOGXSYNMIU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|