C20H22N2O3S — CID 102510446
2-[(2S,3R)-1-(benzenesulfonyl)-2-methyl-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 102510446) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-[(2S,3R)-1-(benzenesulfonyl)-2-methyl-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2S,3R)-1-(benzenesulfonyl)-2-methyl-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 102510446 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[(2S,3R)-1-(benzenesulfonyl)-2-methyl-3-phenylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC([C@]2(C)[C@@H](c3ccccc3)N2S(=O)(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H22N2O3S/c1-19(2)14-25-18(21-19)20(3)17(15-10-6-4-7-11-15)22(20)26(23,24)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3/t17-,20+,22?/m1/s1 |
| InChIKey | HMDANGFCKYNTRV-QIFHVCNWSA-N |
| XLogP | 3.40 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|