C19H18FNO — CID 101338081
9-fluoro-2,2,3-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 101338081) has the molecular formula C19H18FNO and a molecular weight of 295.36 g/mol. Its IUPAC name is 9-fluoro-2,2,3-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 9-fluoro-2,2,3-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 101338081 |
| Molecular Formula | C19H18FNO |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 9-fluoro-2,2,3-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | CC1=Cc2c(ccc3c2COc2ccc(F)cc2-3)NC1(C)C |
| InChI | InChI=1S/C19H18FNO/c1-11-8-14-16-10-22-18-7-4-12(20)9-15(18)13(16)5-6-17(14)21-19(11,2)3/h4-9,21H,10H2,1-3H3 |
| InChIKey | STTSRMDETRNUPZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |