C27H28FNOS — CID 10365592
6-(5-fluoro-2-methoxyphenyl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline (PubChem CID 10365592) has the molecular formula C27H28FNOS and a molecular weight of 433.59 g/mol. Its IUPAC name is 6-(5-fluoro-2-methoxyphenyl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline.
| Compound Name | 6-(5-fluoro-2-methoxyphenyl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline |
|---|---|
| PubChem CID | 10365592 |
| Molecular Formula | C27H28FNOS |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 6-(5-fluoro-2-methoxyphenyl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline |
| SMILES | COc1ccc(F)cc1-c1ccc2c(c1)C(CSCCc1ccccc1)=CC(C)(C)N2 |
| InChI | InChI=1S/C27H28FNOS/c1-27(2)17-21(18-31-14-13-19-7-5-4-6-8-19)23-15-20(9-11-25(23)29-27)24-16-22(28)10-12-26(24)30-3/h4-12,15-17,29H,13-14,18H2,1-3H3 |
| InChIKey | VRGIPALWMYWNEK-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|