C15H26N2O6S — CID 101338601
propyl (4R)-3-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 101338601) has the molecular formula C15H26N2O6S and a molecular weight of 362.45 g/mol. Its IUPAC name is propyl (4R)-3-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | propyl (4R)-3-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 101338601 |
| Molecular Formula | C15H26N2O6S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | propyl (4R)-3-[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]hexanoyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCC[C@@H](C(=O)N1CSC[C@H]1C(=O)OCCC)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C15H26N2O6S/c1-3-5-6-10(12(18)13(19)16-22)14(20)17-9-24-8-11(17)15(21)23-7-4-2/h10-12,18,22H,3-9H2,1-2H3,(H,16,19)/t10-,11+,12+/m1/s1 |
| InChIKey | RZFDXNJZXGBJFG-WOPDTQHZSA-N |
| XLogP | 0.51 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|