C22H27N5S2 — CID 101341213
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]ethyl]ethanamine (PubChem CID 101341213) has the molecular formula C22H27N5S2 and a molecular weight of 425.63 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]ethyl]ethanamine.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]ethyl]ethanamine |
|---|---|
| PubChem CID | 101341213 |
| Molecular Formula | C22H27N5S2 |
| Molecular Weight | 425.63 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]ethyl]ethanamine |
| SMILES | CC(SCCNCCSC(C)c1nc2ccccc2[nH]1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H27N5S2/c1-15(21-24-17-7-3-4-8-18(17)25-21)28-13-11-23-12-14-29-16(2)22-26-19-9-5-6-10-20(19)27-22/h3-10,15-16,23H,11-14H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | VPSGLVXVPPTFQG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|