C34H32F6OS3 — CID 101343604
5-[4-[4-[2-(2,4-dimethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]phenoxy]pentane-1-thiol (PubChem CID 101343604) has the molecular formula C34H32F6OS3 and a molecular weight of 666.82 g/mol. Its IUPAC name is 5-[4-[4-[2-(2,4-dimethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]phenoxy]pentane-1-thiol.
| Compound Name | 5-[4-[4-[2-(2,4-dimethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]phenoxy]pentane-1-thiol |
|---|---|
| PubChem CID | 101343604 |
| Molecular Formula | C34H32F6OS3 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.15 |
| IUPAC Name | 5-[4-[4-[2-(2,4-dimethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]phenoxy]pentane-1-thiol |
| SMILES | Cc1sc(-c2ccccc2)c(C)c1C1=C(c2c(C)sc(-c3ccc(OCCCCCS)cc3)c2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C34H32F6OS3/c1-19-26(21(3)43-30(19)23-11-7-5-8-12-23)28-29(33(37,38)34(39,40)32(28,35)36)27-20(2)31(44-22(27)4)24-13-15-25(16-14-24)41-17-9-6-10-18-42/h5,7-8,11-16,42H,6,9-10,17-18H2,1-4H3 |
| InChIKey | LXSCWNVUKHXXFZ-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|