C24H22ClNO3S — CID 101347129
N-(3-chloro-4-methoxy-8-phenyl-5,8-dihydronaphthalen-1-yl)-4-methylbenzenesulfonamide (PubChem CID 101347129) has the molecular formula C24H22ClNO3S and a molecular weight of 439.96 g/mol. Its IUPAC name is N-(3-chloro-4-methoxy-8-phenyl-5,8-dihydronaphthalen-1-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3-chloro-4-methoxy-8-phenyl-5,8-dihydronaphthalen-1-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101347129 |
| Molecular Formula | C24H22ClNO3S |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-(3-chloro-4-methoxy-8-phenyl-5,8-dihydronaphthalen-1-yl)-4-methylbenzenesulfonamide |
| SMILES | COc1c(Cl)cc(NS(=O)(=O)c2ccc(C)cc2)c2c1CC=CC2c1ccccc1 |
| InChI | InChI=1S/C24H22ClNO3S/c1-16-11-13-18(14-12-16)30(27,28)26-22-15-21(25)24(29-2)20-10-6-9-19(23(20)22)17-7-4-3-5-8-17/h3-9,11-15,19,26H,10H2,1-2H3 |
| InChIKey | KELFTFMTAKEVMB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|