C18H26O3 — CID 101349378
(3'aS,6'Z,9'R,9'aR)-5,5-dimethyl-4'-methylidenespiro[1,3-dioxane-2,2'-3,3a,5,8,9,9a-hexahydro-1H-cyclopenta[8]annulene]-9'-carbaldehyde (PubChem CID 101349378) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3'aS,6'Z,9'R,9'aR)-5,5-dimethyl-4'-methylidenespiro[1,3-dioxane-2,2'-3,3a,5,8,9,9a-hexahydro-1H-cyclopenta[8]annulene]-9'-carbaldehyde.
| Compound Name | (3'aS,6'Z,9'R,9'aR)-5,5-dimethyl-4'-methylidenespiro[1,3-dioxane-2,2'-3,3a,5,8,9,9a-hexahydro-1H-cyclopenta[8]annulene]-9'-carbaldehyde |
|---|---|
| PubChem CID | 101349378 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3'aS,6'Z,9'R,9'aR)-5,5-dimethyl-4'-methylidenespiro[1,3-dioxane-2,2'-3,3a,5,8,9,9a-hexahydro-1H-cyclopenta[8]annulene]-9'-carbaldehyde |
| SMILES | C=C1C/C=C\C[C@@H](C=O)[C@@H]2CC3(C[C@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C18H26O3/c1-13-6-4-5-7-14(10-19)16-9-18(8-15(13)16)20-11-17(2,3)12-21-18/h4-5,10,14-16H,1,6-9,11-12H2,2-3H3/b5-4-/t14-,15+,16-/m0/s1 |
| InChIKey | PSZURQYQAPTXLE-GKLROCHGSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|