C19H22N2O2 — CID 101351230
(3S,4R,9aS)-4-methoxy-3-naphthalen-2-yl-1,2,3,4,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-5-one (PubChem CID 101351230) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (3S,4R,9aS)-4-methoxy-3-naphthalen-2-yl-1,2,3,4,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-5-one.
| Compound Name | (3S,4R,9aS)-4-methoxy-3-naphthalen-2-yl-1,2,3,4,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 101351230 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (3S,4R,9aS)-4-methoxy-3-naphthalen-2-yl-1,2,3,4,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-5-one |
| SMILES | CO[C@H]1C(=O)N2CCC[C@H]2CN[C@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H22N2O2/c1-23-18-17(20-12-16-7-4-10-21(16)19(18)22)15-9-8-13-5-2-3-6-14(13)11-15/h2-3,5-6,8-9,11,16-18,20H,4,7,10,12H2,1H3/t16-,17-,18+/m0/s1 |
| InChIKey | AMXGMANGVAUEQL-OKZBNKHCSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |