C26H26N2O3 — CID 10136533
8-ethoxy-1-ethyl-7-methoxy-3,5-diphenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 10136533) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 8-ethoxy-1-ethyl-7-methoxy-3,5-diphenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 8-ethoxy-1-ethyl-7-methoxy-3,5-diphenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 10136533 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 8-ethoxy-1-ethyl-7-methoxy-3,5-diphenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccccc1)=NC(c1ccccc1)C(=O)N2CC |
| InChI | InChI=1S/C26H26N2O3/c1-4-28-21-17-23(31-5-2)22(30-3)16-20(21)24(18-12-8-6-9-13-18)27-25(26(28)29)19-14-10-7-11-15-19/h6-17,25H,4-5H2,1-3H3 |
| InChIKey | GETNXSJEFJMXMA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |