C21H28O2 — CID 101367358
(1R,12R)-12,15,15,19-tetramethyl-14,16-dioxatetracyclo[9.5.3.01,12.03,8]nonadeca-3,5,7,11(19)-tetraene (PubChem CID 101367358) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (1R,12R)-12,15,15,19-tetramethyl-14,16-dioxatetracyclo[9.5.3.01,12.03,8]nonadeca-3,5,7,11(19)-tetraene.
| Compound Name | (1R,12R)-12,15,15,19-tetramethyl-14,16-dioxatetracyclo[9.5.3.01,12.03,8]nonadeca-3,5,7,11(19)-tetraene |
|---|---|
| PubChem CID | 101367358 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (1R,12R)-12,15,15,19-tetramethyl-14,16-dioxatetracyclo[9.5.3.01,12.03,8]nonadeca-3,5,7,11(19)-tetraene |
| SMILES | CC1=C2CCc3ccccc3C[C@@]3(CC1)OC(C)(C)OC[C@@]23C |
| InChI | InChI=1S/C21H28O2/c1-15-11-12-21-13-17-8-6-5-7-16(17)9-10-18(15)20(21,4)14-22-19(2,3)23-21/h5-8H,9-14H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | HYROAKQVVXGCAG-LEWJYISDSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|