C14H16O2 — CID 134986595
3',4'-dimethylspiro[1,4-dihydroisochromene-3,5'-2H-furan] (PubChem CID 134986595) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3',4'-dimethylspiro[1,4-dihydroisochromene-3,5'-2H-furan].
| Compound Name | 3',4'-dimethylspiro[1,4-dihydroisochromene-3,5'-2H-furan] |
|---|---|
| PubChem CID | 134986595 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 3',4'-dimethylspiro[1,4-dihydroisochromene-3,5'-2H-furan] |
| SMILES | CC1=C(C)C2(Cc3ccccc3CO2)OC1 |
| InChI | InChI=1S/C14H16O2/c1-10-8-15-14(11(10)2)7-12-5-3-4-6-13(12)9-16-14/h3-6H,7-9H2,1-2H3 |
| InChIKey | QTFVPACXHSODGZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|