C12H13NO — CID 123928664
3'-methylspiro[1,3-dihydroindene-2,5'-2H-1,2-oxazole] (PubChem CID 123928664) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 3'-methylspiro[1,3-dihydroindene-2,5'-2H-1,2-oxazole].
| Compound Name | 3'-methylspiro[1,3-dihydroindene-2,5'-2H-1,2-oxazole] |
|---|---|
| PubChem CID | 123928664 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 3'-methylspiro[1,3-dihydroindene-2,5'-2H-1,2-oxazole] |
| SMILES | CC1=CC2(Cc3ccccc3C2)ON1 |
| InChI | InChI=1S/C12H13NO/c1-9-6-12(14-13-9)7-10-4-2-3-5-11(10)8-12/h2-6,13H,7-8H2,1H3 |
| InChIKey | ILECTSZIZGNIGV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |