C17H28 — CID 143082444
ethane;2,2,4-trimethyl-1H-naphthalene (PubChem CID 143082444) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is ethane;2,2,4-trimethyl-1H-naphthalene.
| Compound Name | ethane;2,2,4-trimethyl-1H-naphthalene |
|---|---|
| PubChem CID | 143082444 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | ethane;2,2,4-trimethyl-1H-naphthalene |
| SMILES | CC.CC.CC1=CC(C)(C)Cc2ccccc21 |
| InChI | InChI=1S/C13H16.2C2H6/c1-10-8-13(2,3)9-11-6-4-5-7-12(10)11;2*1-2/h4-8H,9H2,1-3H3;2*1-2H3 |
| InChIKey | HFCUOWMVGFHXBF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |