C12H16ClN — CID 44654585
1,3,3-trimethyl-4H-isoquinolin-2-ium chloride (PubChem CID 44654585) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 1,3,3-trimethyl-4H-isoquinolin-2-ium chloride.
| Compound Name | 1,3,3-trimethyl-4H-isoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 44654585 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1,3,3-trimethyl-4H-isoquinolin-2-ium chloride |
| SMILES | CC1=[NH+]C(C)(C)Cc2ccccc21.[Cl-] |
| InChI | InChI=1S/C12H15N.ClH/c1-9-11-7-5-4-6-10(11)8-12(2,3)13-9;/h4-7H,8H2,1-3H3;1H |
| InChIKey | JAOGQYKPUONGAZ-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |