C17H27N — CID 91296495
ethane;N,2,2,3,3-pentamethyl-4H-naphthalen-1-imine (PubChem CID 91296495) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is ethane;N,2,2,3,3-pentamethyl-4H-naphthalen-1-imine.
| Compound Name | ethane;N,2,2,3,3-pentamethyl-4H-naphthalen-1-imine |
|---|---|
| PubChem CID | 91296495 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | ethane;N,2,2,3,3-pentamethyl-4H-naphthalen-1-imine |
| SMILES | C/N=C1\c2ccccc2CC(C)(C)C1(C)C.CC |
| InChI | InChI=1S/C15H21N.C2H6/c1-14(2)10-11-8-6-7-9-12(11)13(16-5)15(14,3)4;1-2/h6-9H,10H2,1-5H3;1-2H3/b16-13+; |
| InChIKey | UCCAHYFJOSBZCB-ZUQRMPMESA-N |
| XLogP | 4.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|