C24H24N2O3S2 — CID 101367690
N-[[(1aS,7bS)-1a,2,3,7b-tetrahydronaphtho[1,2-b]azirin-1-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 101367690) has the molecular formula C24H24N2O3S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[[(1aS,7bS)-1a,2,3,7b-tetrahydronaphtho[1,2-b]azirin-1-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(1aS,7bS)-1a,2,3,7b-tetrahydronaphtho[1,2-b]azirin-1-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101367690 |
| Molecular Formula | C24H24N2O3S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[[(1aS,7bS)-1a,2,3,7b-tetrahydronaphtho[1,2-b]azirin-1-yl]-(4-methylphenyl)-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(c2ccc(C)cc2)N2[C@H]3CCc4ccccc4[C@@H]32)cc1 |
| InChI | InChI=1S/C24H24N2O3S2/c1-17-7-12-20(13-8-17)30(27,25-31(28,29)21-14-9-18(2)10-15-21)26-23-16-11-19-5-3-4-6-22(19)24(23)26/h3-10,12-15,23-24H,11,16H2,1-2H3/t23-,24-,26?,30?/m0/s1 |
| InChIKey | NVCOSDASYKIQRC-IECVDBFGSA-N |
| XLogP | 4.81 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|