C20H26N2O3S2 — CID 101367684
4-methyl-N-[(4-methylphenyl)-[(2S,3S)-2-methyl-3-propylaziridin-1-yl]-oxo-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 101367684) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-methyl-N-[(4-methylphenyl)-[(2S,3S)-2-methyl-3-propylaziridin-1-yl]-oxo-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(4-methylphenyl)-[(2S,3S)-2-methyl-3-propylaziridin-1-yl]-oxo-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 101367684 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-methyl-N-[(4-methylphenyl)-[(2S,3S)-2-methyl-3-propylaziridin-1-yl]-oxo-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | CCC[C@H]1[C@H](C)N1S(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H26N2O3S2/c1-5-6-20-17(4)22(20)26(23,18-11-7-15(2)8-12-18)21-27(24,25)19-13-9-16(3)10-14-19/h7-14,17,20H,5-6H2,1-4H3/t17-,20-,22?,26?/m0/s1 |
| InChIKey | UCKMVBHOWNGZDU-NMCHAEMFSA-N |
| XLogP | 4.31 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|