C13H25N5O2 — CID 101368685
N-[2-[2-[2-(aminomethylamino)ethyl-prop-2-enoylamino]ethylamino]ethyl]prop-2-enamide (PubChem CID 101368685) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-[2-[2-[2-(aminomethylamino)ethyl-prop-2-enoylamino]ethylamino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[2-[2-(aminomethylamino)ethyl-prop-2-enoylamino]ethylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 101368685 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N-[2-[2-[2-(aminomethylamino)ethyl-prop-2-enoylamino]ethylamino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNCCN(CCNCN)C(=O)C=C |
| InChI | InChI=1S/C13H25N5O2/c1-3-12(19)17-6-5-15-7-9-18(13(20)4-2)10-8-16-11-14/h3-4,15-16H,1-2,5-11,14H2,(H,17,19) |
| InChIKey | SNGDRZPZMUVPSA-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|