C32H66O5Si3 — CID 101369340
tert-butyl (2E,4E)-3,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]deca-2,4-dienoate (PubChem CID 101369340) has the molecular formula C32H66O5Si3 and a molecular weight of 615.13 g/mol. Its IUPAC name is tert-butyl (2E,4E)-3,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]deca-2,4-dienoate.
| Compound Name | tert-butyl (2E,4E)-3,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]deca-2,4-dienoate |
|---|---|
| PubChem CID | 101369340 |
| Molecular Formula | C32H66O5Si3 |
| Molecular Weight | 615.13 g/mol |
| Exact Mass | 614.42 |
| IUPAC Name | tert-butyl (2E,4E)-3,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]deca-2,4-dienoate |
| SMILES | CCC(CC/C(=C\C(=C/C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H66O5Si3/c1-20-25(35-38(14,15)30(5,6)7)21-22-26(36-39(16,17)31(8,9)10)23-27(24-28(33)34-29(2,3)4)37-40(18,19)32(11,12)13/h23-25H,20-22H2,1-19H3/b26-23+,27-24+ |
| InChIKey | UVHIYGNTXSRZQE-LSBUKLHESA-N |
| XLogP | 10.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.13 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|