C22H44O4Si2 — CID 139888274
ethyl (2E)-2-[2,2-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]acetate (PubChem CID 139888274) has the molecular formula C22H44O4Si2 and a molecular weight of 428.76 g/mol. Its IUPAC name is ethyl (2E)-2-[2,2-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]acetate.
| Compound Name | ethyl (2E)-2-[2,2-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]acetate |
|---|---|
| PubChem CID | 139888274 |
| Molecular Formula | C22H44O4Si2 |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | ethyl (2E)-2-[2,2-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CCCCC1(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O4Si2/c1-12-24-19(23)17-18-15-13-14-16-22(18,25-27(8,9)20(2,3)4)26-28(10,11)21(5,6)7/h17H,12-16H2,1-11H3/b18-17+ |
| InChIKey | GTMLOAPTXJPWNP-ISLYRVAYSA-N |
| XLogP | 6.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|