C17H29FO3Si — CID 14483734
ethyl (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]acetate (PubChem CID 14483734) has the molecular formula C17H29FO3Si and a molecular weight of 328.50 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 14483734 |
| Molecular Formula | C17H29FO3Si |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | ethyl (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1/C(=C\C(=O)OCC)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C17H29FO3Si/c1-8-20-16(19)10-13-9-14(11-15(18)12(13)2)21-22(6,7)17(3,4)5/h10,14-15H,2,8-9,11H2,1,3-7H3/b13-10-/t14-,15+/m1/s1 |
| InChIKey | ZVZYGJSQPNSFCC-GHRAKNKNSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|