C19H33FO3Si — CID 10948275
tert-butyl (2E)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(fluoromethyl)cyclohex-2-en-1-ylidene]acetate (PubChem CID 10948275) has the molecular formula C19H33FO3Si and a molecular weight of 356.55 g/mol. Its IUPAC name is tert-butyl (2E)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(fluoromethyl)cyclohex-2-en-1-ylidene]acetate.
| Compound Name | tert-butyl (2E)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(fluoromethyl)cyclohex-2-en-1-ylidene]acetate |
|---|---|
| PubChem CID | 10948275 |
| Molecular Formula | C19H33FO3Si |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | tert-butyl (2E)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(fluoromethyl)cyclohex-2-en-1-ylidene]acetate |
| SMILES | CC(C)(C)OC(=O)/C=C1\C[C@@H](O[Si](C)(C)C(C)(C)C)CC=C1CF |
| InChI | InChI=1S/C19H33FO3Si/c1-18(2,3)22-17(21)12-15-11-16(10-9-14(15)13-20)23-24(7,8)19(4,5)6/h9,12,16H,10-11,13H2,1-8H3/b15-12+/t16-/m0/s1 |
| InChIKey | RAYFKPKIWNBKGK-STTHAQSSSA-N |
| XLogP | 5.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|